C11H14BrN3O4S — CID 106181148
5-amino-4-bromo-2-methoxy-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106181148) has the molecular formula C11H14BrN3O4S and a molecular weight of 364.22 g/mol. Its IUPAC name is 5-amino-4-bromo-2-methoxy-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-methoxy-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106181148 |
| Molecular Formula | C11H14BrN3O4S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 5-amino-4-bromo-2-methoxy-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)NC1CNC(=O)C1 |
| InChI | InChI=1S/C11H14BrN3O4S/c1-19-9-3-7(12)8(13)4-10(9)20(17,18)15-6-2-11(16)14-5-6/h3-4,6,15H,2,5,13H2,1H3,(H,14,16) |
| InChIKey | YNDVMVIGKOWRED-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|