About 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one
4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one (PubChem CID 114155142) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one |
| PubChem CID | 114155142 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one |
| SMILES | COc1cc(N)c(NC2CNC(=O)C2)cc1OC |
| InChI | InChI=1S/C12H17N3O3/c1-17-10-4-8(13)9(5-11(10)18-2)15-7-3-12(16)14-6-7/h4-5,7,15H,3,6,13H2,1-2H3,(H,14,16) |
| InChIKey | YHFSZQBYNKQXGH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one?
The IUPAC name of 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one (CID 114155142) is 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one.
What is the SMILES notation for 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one?
The canonical SMILES for 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one is COc1cc(N)c(NC2CNC(=O)C2)cc1OC.
What is the InChIKey of 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one?
The InChIKey is YHFSZQBYNKQXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-17-10-4-8(13)9(5-11(10)18-2)15-7-3-12(16)14-6-7/h4-5,7,15H,3,6,13H2,1-2H3,(H,14,16).
What are the key properties of 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one?
4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one has a molecular weight of 251.29 g/mol, XLogP of 0.59, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4,5-dimethoxyanilino)pyrrolidin-2-one is sourced from PubChem (CID 114155142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).