C12H18N2O4S — CID 83001346
2-N-(1,1-dioxothiolan-3-yl)-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 83001346) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-4,5-dimethoxybenzene-1,2-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-4,5-dimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 83001346 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(N)c(NC2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C12H18N2O4S/c1-17-11-5-9(13)10(6-12(11)18-2)14-8-3-4-19(15,16)7-8/h5-6,8,14H,3-4,7,13H2,1-2H3 |
| InChIKey | MQUITWZLUWMVPO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|