C10H13ClN2O2S — CID 43115448
4-chloro-1-N-(1,1-dioxothiolan-3-yl)benzene-1,2-diamine (PubChem CID 43115448) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 4-chloro-1-N-(1,1-dioxothiolan-3-yl)benzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-(1,1-dioxothiolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43115448 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-chloro-1-N-(1,1-dioxothiolan-3-yl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)ccc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13ClN2O2S/c11-7-1-2-10(9(12)5-7)13-8-3-4-16(14,15)6-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | TWOFLKWAWGNGTE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|