C10H10Cl3NO2S — CID 43126505
1,1-dioxo-N-(2,4,6-trichlorophenyl)thiolan-3-amine (PubChem CID 43126505) has the molecular formula C10H10Cl3NO2S and a molecular weight of 314.62 g/mol. Its IUPAC name is 1,1-dioxo-N-(2,4,6-trichlorophenyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(2,4,6-trichlorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 43126505 |
| Molecular Formula | C10H10Cl3NO2S |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 1,1-dioxo-N-(2,4,6-trichlorophenyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C10H10Cl3NO2S/c11-6-3-8(12)10(9(13)4-6)14-7-1-2-17(15,16)5-7/h3-4,7,14H,1-2,5H2 |
| InChIKey | VDYSEHYWAYIWPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |