C14H15ClN2O2S — CID 63162713
6-chloro-N-(1,1-dioxothiolan-3-yl)-8-methylquinolin-5-amine (PubChem CID 63162713) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothiolan-3-yl)-8-methylquinolin-5-amine.
| Compound Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-8-methylquinolin-5-amine |
|---|---|
| PubChem CID | 63162713 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-8-methylquinolin-5-amine |
| SMILES | Cc1cc(Cl)c(NC2CCS(=O)(=O)C2)c2cccnc12 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-9-7-12(15)14(11-3-2-5-16-13(9)11)17-10-4-6-20(18,19)8-10/h2-3,5,7,10,17H,4,6,8H2,1H3 |
| InChIKey | NVBJNZFKUUMHMV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |