C18H16N2O3S — CID 71895819
N-(1,1-dioxothiolan-3-yl)benzo[f]quinoline-5-carboxamide (PubChem CID 71895819) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)benzo[f]quinoline-5-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)benzo[f]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 71895819 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)benzo[f]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc2ccccc2c2cccnc12 |
| InChI | InChI=1S/C18H16N2O3S/c21-18(20-13-7-9-24(22,23)11-13)16-10-12-4-1-2-5-14(12)15-6-3-8-19-17(15)16/h1-6,8,10,13H,7,9,11H2,(H,20,21) |
| InChIKey | URAHZALNUDCIGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|