C11H12BrNO3S — CID 7259720
2-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7259720) has the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7259720 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1ccccc1Br |
| InChI | InChI=1S/C11H12BrNO3S/c12-10-4-2-1-3-9(10)11(14)13-8-5-6-17(15,16)7-8/h1-4,8H,5-7H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | KIVHOUOKFPDDBN-QMMMGPOBSA-N |
| XLogP | 1.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |