C17H18N2O3S — CID 27710336
2-anilino-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 27710336) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-anilino-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2-anilino-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 27710336 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-anilino-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S/c20-17(19-14-10-11-23(21,22)12-14)15-8-4-5-9-16(15)18-13-6-2-1-3-7-13/h1-9,14,18H,10-12H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | UXTRFYXZPKPJBD-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |