C11H11BrClNO3S — CID 103980277
3-bromo-2-chloro-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 103980277) has the molecular formula C11H11BrClNO3S and a molecular weight of 352.64 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-bromo-2-chloro-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 103980277 |
| Molecular Formula | C11H11BrClNO3S |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 3-bromo-2-chloro-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C11H11BrClNO3S/c12-9-3-1-2-8(10(9)13)11(15)14-7-4-5-18(16,17)6-7/h1-3,7H,4-6H2,(H,14,15) |
| InChIKey | LWZVGXXXGNBHFQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |