C11H11Cl2NO3S — CID 7090741
2,4-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7090741) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7090741 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2,4-dichloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3S/c12-7-1-2-9(10(13)5-7)11(15)14-8-3-4-18(16,17)6-8/h1-2,5,8H,3-4,6H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | ASIPTGWPEDTTII-QMMMGPOBSA-N |
| XLogP | 1.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |