C11H12ClNO4S — CID 43176547
4-chloro-N-(1,1-dioxothiolan-3-yl)-2-hydroxybenzamide (PubChem CID 43176547) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothiolan-3-yl)-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 43176547 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-2-hydroxybenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C11H12ClNO4S/c12-7-1-2-9(10(14)5-7)11(15)13-8-3-4-18(16,17)6-8/h1-2,5,8,14H,3-4,6H2,(H,13,15) |
| InChIKey | JACRLUTZLJKSCK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |