C11H12ClNO3S — CID 7259712
3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7259712) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7259712 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-9-3-1-2-8(6-9)11(14)13-10-4-5-17(15,16)7-10/h1-3,6,10H,4-5,7H2,(H,13,14)/t10-/m0/s1 |
| InChIKey | LZMLIMWLBRIHHD-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |