C13H18N2O3S — CID 51240308
3-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 51240308) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 51240308 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(dimethylamino)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CN(C)c1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H18N2O3S/c1-15(2)12-5-3-4-10(8-12)13(16)14-11-6-7-19(17,18)9-11/h3-5,8,11H,6-7,9H2,1-2H3,(H,14,16) |
| InChIKey | NDACBVZLFCEVCR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |