C12H14ClNO3S — CID 43156321
3-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 43156321) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 43156321 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cccc(CCl)c1 |
| InChI | InChI=1S/C12H14ClNO3S/c13-7-9-2-1-3-10(6-9)12(15)14-11-4-5-18(16,17)8-11/h1-3,6,11H,4-5,7-8H2,(H,14,15) |
| InChIKey | JGYZMADCCDPSPQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|