C14H15NO5S — CID 76907236
3-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 76907236) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907236 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H15NO5S/c16-13(17)5-4-10-2-1-3-11(8-10)14(18)15-12-6-7-21(19,20)9-12/h1-5,8,12H,6-7,9H2,(H,15,18)(H,16,17) |
| InChIKey | OQOGUYMMUGUNPI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|