C13H15NO3S — CID 7064383
(E)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide (PubChem CID 7064383) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is (E)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7064383 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (E)-N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO3S/c15-13(7-6-11-4-2-1-3-5-11)14-12-8-9-18(16,17)10-12/h1-7,12H,8-10H2,(H,14,15)/b7-6+/t12-/m0/s1 |
| InChIKey | ISTCODLRPRHJKI-SYTKJHMZSA-N |
| XLogP | 1.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|