C13H14ClNO3S — CID 3108456
3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 3108456) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3108456 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14ClNO3S/c14-11-4-1-10(2-5-11)3-6-13(16)15-12-7-8-19(17,18)9-12/h1-6,12H,7-9H2,(H,15,16) |
| InChIKey | GAGSGKCTYQGRBD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|