C14H16N2O3S2 — CID 18823216
(E)-N-[(1,1-dioxothiolan-3-yl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 18823216) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is (E)-N-[(1,1-dioxothiolan-3-yl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1,1-dioxothiolan-3-yl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18823216 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (E)-N-[(1,1-dioxothiolan-3-yl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O3S2/c17-13(7-6-11-4-2-1-3-5-11)16-14(20)15-12-8-9-21(18,19)10-12/h1-7,12H,8-10H2,(H2,15,16,17,20)/b7-6+ |
| InChIKey | FMHRTHDSPLPIIZ-VOTSOKGWSA-N |
| XLogP | 0.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|