C15H18N2O4S — CID 8938629
(E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenylprop-2-enehydrazide (PubChem CID 8938629) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 8938629 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenylprop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccccc1)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O4S/c18-14(7-6-12-4-2-1-3-5-12)16-17-15(19)10-13-8-9-22(20,21)11-13/h1-7,13H,8-11H2,(H,16,18)(H,17,19)/b7-6+/t13-/m1/s1 |
| InChIKey | AIVPGIAAERYOLJ-KTRBRXNASA-N |
| XLogP | 0.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|