C19H20N2O4S — CID 42888277
N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-4-phenylbenzohydrazide (PubChem CID 42888277) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-4-phenylbenzohydrazide.
| Compound Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-4-phenylbenzohydrazide |
|---|---|
| PubChem CID | 42888277 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-4-phenylbenzohydrazide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c22-18(12-14-10-11-26(24,25)13-14)20-21-19(23)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-9,14H,10-13H2,(H,20,22)(H,21,23) |
| InChIKey | YSYAHONEAUWXQY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|