C16H22N2O4S — CID 8938663
N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4-propan-2-ylbenzohydrazide (PubChem CID 8938663) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4-propan-2-ylbenzohydrazide.
| Compound Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4-propan-2-ylbenzohydrazide |
|---|---|
| PubChem CID | 8938663 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4-propan-2-ylbenzohydrazide |
| SMILES | CC(C)c1ccc(C(=O)NNC(=O)C[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-11(2)13-3-5-14(6-4-13)16(20)18-17-15(19)9-12-7-8-23(21,22)10-12/h3-6,11-12H,7-10H2,1-2H3,(H,17,19)(H,18,20)/t12-/m1/s1 |
| InChIKey | YPPKVUCRAPOZAZ-GFCCVEGCSA-N |
| XLogP | 1.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|