C17H23ClN2O4S — CID 8939037
(2S)-2-(4-chlorophenyl)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methylbutanehydrazide (PubChem CID 8939037) has the molecular formula C17H23ClN2O4S and a molecular weight of 386.90 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methylbutanehydrazide.
| Compound Name | (2S)-2-(4-chlorophenyl)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 8939037 |
| Molecular Formula | C17H23ClN2O4S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3-methylbutanehydrazide |
| SMILES | CC(C)[C@H](C(=O)NNC(=O)C[C@@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O4S/c1-11(2)16(13-3-5-14(18)6-4-13)17(22)20-19-15(21)9-12-7-8-25(23,24)10-12/h3-6,11-12,16H,7-10H2,1-2H3,(H,19,21)(H,20,22)/t12-,16-/m0/s1 |
| InChIKey | PLQSWDRHAJFZHY-LRDDRELGSA-N |
| XLogP | 2.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|