C14H18ClNO3S — CID 9268417
N-[2-(4-chlorophenyl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 9268417) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 9268417 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3S/c15-13-3-1-11(2-4-13)5-7-16-14(17)9-12-6-8-20(18,19)10-12/h1-4,12H,5-10H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | WSDKJNKFKSKCHL-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |