C17H24ClNO3S — CID 110417130
4-(4-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]butanamide (PubChem CID 110417130) has the molecular formula C17H24ClNO3S and a molecular weight of 357.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]butanamide |
|---|---|
| PubChem CID | 110417130 |
| Molecular Formula | C17H24ClNO3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24ClNO3S/c18-16-8-6-14(7-9-16)3-1-5-17(20)19-11-2-4-15-10-12-23(21,22)13-15/h6-9,15H,1-5,10-13H2,(H,19,20) |
| InChIKey | OVJUPUXXCKRPRK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|