C13H25NO3S — CID 110602993
N-[3-(1,1-dioxothiolan-3-yl)propyl]-3,3-dimethylbutanamide (PubChem CID 110602993) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-3,3-dimethylbutanamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 110602993 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO3S/c1-13(2,3)9-12(15)14-7-4-5-11-6-8-18(16,17)10-11/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | ZARXGYDILCQTBF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|