C18H27NO3S — CID 110417136
N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenylpentanamide (PubChem CID 110417136) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenylpentanamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 110417136 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenylpentanamide |
| SMILES | O=C(CCCCc1ccccc1)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H27NO3S/c20-18(11-5-4-9-16-7-2-1-3-8-16)19-13-6-10-17-12-14-23(21,22)15-17/h1-3,7-8,17H,4-6,9-15H2,(H,19,20) |
| InChIKey | LNFYRXKUVIRRQB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|