C17H25NO5S2 — CID 110617358
N-[3-(1,1-dioxothiolan-3-yl)propyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 110617358) has the molecular formula C17H25NO5S2 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 110617358 |
| Molecular Formula | C17H25NO5S2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCCCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H25NO5S2/c1-14-4-6-16(7-5-14)25(22,23)12-9-17(19)18-10-2-3-15-8-11-24(20,21)13-15/h4-7,15H,2-3,8-13H2,1H3,(H,18,19) |
| InChIKey | PYFDJWYMIMWQBK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|