C13H20N2O4S — CID 110610688
N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 110610688) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 110610688 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NCCCC2CCS(=O)(=O)C2)no1 |
| InChI | InChI=1S/C13H20N2O4S/c1-10-7-12(15-19-10)8-13(16)14-5-2-3-11-4-6-20(17,18)9-11/h7,11H,2-6,8-9H2,1H3,(H,14,16) |
| InChIKey | DKJLRKOEELZWKO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|