C17H20N2O4S — CID 110619727
N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 110619727) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110619727 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H20N2O4S/c20-17(18-9-4-5-13-8-10-24(21,22)12-13)15-11-16(23-19-15)14-6-2-1-3-7-14/h1-3,6-7,11,13H,4-5,8-10,12H2,(H,18,20) |
| InChIKey | AGBXRHJSBVSSOF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|