C20H27N3O3S — CID 110417159
5-(3,4-dimethylphenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-methylpyrazole-3-carboxamide (PubChem CID 110417159) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110417159 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCCC3CCS(=O)(=O)C3)nn2C)cc1C |
| InChI | InChI=1S/C20H27N3O3S/c1-14-6-7-17(11-15(14)2)19-12-18(22-23(19)3)20(24)21-9-4-5-16-8-10-27(25,26)13-16/h6-7,11-12,16H,4-5,8-10,13H2,1-3H3,(H,21,24) |
| InChIKey | UVWOLMUCCQGCQS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|