C14H18BrNO3S — CID 110602969
3-bromo-N-[3-(1,1-dioxothiolan-3-yl)propyl]benzamide (PubChem CID 110602969) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is 3-bromo-N-[3-(1,1-dioxothiolan-3-yl)propyl]benzamide.
| Compound Name | 3-bromo-N-[3-(1,1-dioxothiolan-3-yl)propyl]benzamide |
|---|---|
| PubChem CID | 110602969 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 3-bromo-N-[3-(1,1-dioxothiolan-3-yl)propyl]benzamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrNO3S/c15-13-5-1-4-12(9-13)14(17)16-7-2-3-11-6-8-20(18,19)10-11/h1,4-5,9,11H,2-3,6-8,10H2,(H,16,17) |
| InChIKey | SMUZPRHPLDMVHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|