C13H15BrN2O4S — CID 51240327
3-bromo-N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]benzamide (PubChem CID 51240327) has the molecular formula C13H15BrN2O4S and a molecular weight of 375.24 g/mol. Its IUPAC name is 3-bromo-N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 51240327 |
| Molecular Formula | C13H15BrN2O4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 3-bromo-N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15BrN2O4S/c14-10-3-1-2-9(6-10)13(18)15-7-12(17)16-11-4-5-21(19,20)8-11/h1-3,6,11H,4-5,7-8H2,(H,15,18)(H,16,17) |
| InChIKey | HOXXKBQNFFGLFU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |