C15H20N2O4S — CID 46559066
N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 46559066) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 46559066 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-10-5-11(2)7-12(6-10)15(19)16-8-14(18)17-13-3-4-22(20,21)9-13/h5-7,13H,3-4,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | ACNVISXYMWDXGL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |