C16H16N2O6S — CID 110673344
N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-2-oxochromene-3-carboxamide (PubChem CID 110673344) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110673344 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(CNC(=O)c1cc2ccccc2oc1=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16N2O6S/c19-14(18-11-5-6-25(22,23)9-11)8-17-15(20)12-7-10-3-1-2-4-13(10)24-16(12)21/h1-4,7,11H,5-6,8-9H2,(H,17,20)(H,18,19) |
| InChIKey | UNVQRIXDDHUYDL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|