C18H16N2O5S3 — CID 27185048
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 27185048) has the molecular formula C18H16N2O5S3 and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 27185048 |
| Molecular Formula | C18H16N2O5S3 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2cc3ccccc3oc2=O)cs1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H16N2O5S3/c21-16(19-12-5-6-28(23,24)10-12)9-27-18-20-14(8-26-18)13-7-11-3-1-2-4-15(11)25-17(13)22/h1-4,7-8,12H,5-6,9-10H2,(H,19,21)/t12-/m1/s1 |
| InChIKey | MFEDLRQNRDEUBX-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|