C18H16N2O4S2 — CID 16644544
3-[2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 16644544) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 16644544 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-[2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=C(CSc1nc(-c2cc3ccccc3oc2=O)cs1)N1CCOCC1 |
| InChI | InChI=1S/C18H16N2O4S2/c21-16(20-5-7-23-8-6-20)11-26-18-19-14(10-25-18)13-9-12-3-1-2-4-15(12)24-17(13)22/h1-4,9-10H,5-8,11H2 |
| InChIKey | WMVRRWKNVZIGGB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|