C14H10N2O2S — CID 154050171
3-[2-(2-aminoethenyl)-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 154050171) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-[2-(2-aminoethenyl)-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-(2-aminoethenyl)-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 154050171 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[2-(2-aminoethenyl)-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | NC=Cc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C14H10N2O2S/c15-6-5-13-16-11(8-19-13)10-7-9-3-1-2-4-12(9)18-14(10)17/h1-8H,15H2 |
| InChIKey | COMBAJYGGUELNW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|