C22H12N2O5S — CID 135472690
4-hydroxy-3-[(E)-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]iminomethyl]chromen-2-one (PubChem CID 135472690) has the molecular formula C22H12N2O5S and a molecular weight of 416.41 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]iminomethyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(E)-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]iminomethyl]chromen-2-one |
|---|---|
| PubChem CID | 135472690 |
| Molecular Formula | C22H12N2O5S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-hydroxy-3-[(E)-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]iminomethyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(/N=C/c2c(O)c3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C22H12N2O5S/c25-19-13-6-2-4-8-18(13)29-21(27)15(19)10-23-22-24-16(11-30-22)14-9-12-5-1-3-7-17(12)28-20(14)26/h1-11,25H/b23-10+ |
| InChIKey | MULYMYZBKJFARB-AUEPDCJTSA-N |
| XLogP | 4.48 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|