C12H8N4O3 — CID 135535959
4-hydroxy-3-[(E)-1,2,4-triazol-4-yliminomethyl]chromen-2-one (PubChem CID 135535959) has the molecular formula C12H8N4O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-1,2,4-triazol-4-yliminomethyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(E)-1,2,4-triazol-4-yliminomethyl]chromen-2-one |
|---|---|
| PubChem CID | 135535959 |
| Molecular Formula | C12H8N4O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-hydroxy-3-[(E)-1,2,4-triazol-4-yliminomethyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1/C=N/n1cnnc1 |
| InChI | InChI=1S/C12H8N4O3/c17-11-8-3-1-2-4-10(8)19-12(18)9(11)5-15-16-6-13-14-7-16/h1-7,17H/b15-5+ |
| InChIKey | HQPOFKHMYKBRFN-PJQLUOCWSA-N |
| XLogP | 0.97 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|