C21H15N7O3 — CID 137251036
4-hydroxy-3-[[4-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]phenyl]iminomethyl]chromen-2-one (PubChem CID 137251036) has the molecular formula C21H15N7O3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]phenyl]iminomethyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[[4-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]phenyl]iminomethyl]chromen-2-one |
|---|---|
| PubChem CID | 137251036 |
| Molecular Formula | C21H15N7O3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-hydroxy-3-[[4-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]phenyl]iminomethyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1/C=N/c1ccc(-c2n[nH]c(Cn3cncn3)n2)cc1 |
| InChI | InChI=1S/C21H15N7O3/c29-19-15-3-1-2-4-17(15)31-21(30)16(19)9-23-14-7-5-13(6-8-14)20-25-18(26-27-20)10-28-12-22-11-24-28/h1-9,11-12,29H,10H2,(H,25,26,27)/b23-9+ |
| InChIKey | LTXFUBWXBGCOFL-NUGSKGIGSA-N |
| XLogP | 2.67 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|