C16H10ClNO4 — CID 137304097
3-[(4-chlorophenyl)iminomethyl]-4,7-dihydroxychromen-2-one (PubChem CID 137304097) has the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)iminomethyl]-4,7-dihydroxychromen-2-one.
| Compound Name | 3-[(4-chlorophenyl)iminomethyl]-4,7-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 137304097 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-[(4-chlorophenyl)iminomethyl]-4,7-dihydroxychromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(O)c1/C=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10ClNO4/c17-9-1-3-10(4-2-9)18-8-13-15(20)12-6-5-11(19)7-14(12)22-16(13)21/h1-8,19-20H/b18-8+ |
| InChIKey | ONJXABMSTPUESK-QGMBQPNBSA-N |
| XLogP | 3.61 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|