C10H7NO5 — CID 54698717
4,7-dihydroxy-2-oxochromene-3-carboxamide (PubChem CID 54698717) has the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. Its IUPAC name is 4,7-dihydroxy-2-oxochromene-3-carboxamide.
| Compound Name | 4,7-dihydroxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 54698717 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4,7-dihydroxy-2-oxochromene-3-carboxamide |
| SMILES | NC(=O)c1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C10H7NO5/c11-9(14)7-8(13)5-2-1-4(12)3-6(5)16-10(7)15/h1-3,12-13H,(H2,11,14) |
| InChIKey | SIDJYUZYTNRPCY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|