C10H7NO6 — CID 123577970
(4,7-dihydroxy-2-oxochromen-3-yl)carbamic acid (PubChem CID 123577970) has the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. Its IUPAC name is (4,7-dihydroxy-2-oxochromen-3-yl)carbamic acid.
| Compound Name | (4,7-dihydroxy-2-oxochromen-3-yl)carbamic acid |
|---|---|
| PubChem CID | 123577970 |
| Molecular Formula | C10H7NO6 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | (4,7-dihydroxy-2-oxochromen-3-yl)carbamic acid |
| SMILES | O=C(O)Nc1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C10H7NO6/c12-4-1-2-5-6(3-4)17-9(14)7(8(5)13)11-10(15)16/h1-3,11-13H,(H,15,16) |
| InChIKey | SZNUIPQTYNULPE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|