C11H7NO6 — CID 54695489
2-(4,7-dihydroxy-2-oxochromen-3-yl)-2-oxoacetamide (PubChem CID 54695489) has the molecular formula C11H7NO6 and a molecular weight of 249.18 g/mol. Its IUPAC name is 2-(4,7-dihydroxy-2-oxochromen-3-yl)-2-oxoacetamide.
| Compound Name | 2-(4,7-dihydroxy-2-oxochromen-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 54695489 |
| Molecular Formula | C11H7NO6 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2-(4,7-dihydroxy-2-oxochromen-3-yl)-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C11H7NO6/c12-10(16)9(15)7-8(14)5-2-1-4(13)3-6(5)18-11(7)17/h1-3,13-14H,(H2,12,16) |
| InChIKey | VYYLMEPSWIZNRM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|