C12H9O5- — CID 6921838
2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate (PubChem CID 6921838) has the molecular formula C12H9O5- and a molecular weight of 233.20 g/mol. Its IUPAC name is 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate.
| Compound Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate |
|---|---|
| PubChem CID | 6921838 |
| Molecular Formula | C12H9O5- |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate |
| SMILES | Cc1c(CC(=O)[O-])c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C12H10O5/c1-6-8-3-2-7(13)4-10(8)17-12(16)9(6)5-11(14)15/h2-4,13H,5H2,1H3,(H,14,15)/p-1 |
| InChIKey | OOGKDHCQSZAEQI-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|