C18H15AsO3 — CID 88930307
CID 88930307 (PubChem CID 88930307) has the molecular formula C18H15AsO3 and a molecular weight of 354.24 g/mol.
| Compound Name | CID 88930307 |
|---|---|
| PubChem CID | 88930307 |
| Molecular Formula | C18H15AsO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | — |
| SMILES | Cc1c([As])cccc1Cc1c(C)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C18H15AsO3/c1-10-12(4-3-5-16(10)19)8-15-11(2)14-7-6-13(20)9-17(14)22-18(15)21/h3-7,9,20H,8H2,1-2H3 |
| InChIKey | ZMORRABZDVIQJS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|