C11H10O5 — CID 58676736
7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one (PubChem CID 58676736) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one.
| Compound Name | 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one |
|---|---|
| PubChem CID | 58676736 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(CO)c1CO |
| InChI | InChI=1S/C11H10O5/c12-4-8-7-2-1-6(14)3-10(7)16-11(15)9(8)5-13/h1-3,12-14H,4-5H2 |
| InChIKey | WFQDEIGIYSNSFY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|