About 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one
7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one (PubChem CID 58676736) has the molecular formula C11H10O5
and a molecular weight of 222.20 g/mol. Its IUPAC name is 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one.
Molecular Properties
| Compound Name | 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one |
| PubChem CID | 58676736 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(CO)c1CO |
| InChI | InChI=1S/C11H10O5/c12-4-8-7-2-1-6(14)3-10(7)16-11(15)9(8)5-13/h1-3,12-14H,4-5H2 |
| InChIKey | WFQDEIGIYSNSFY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one?
The IUPAC name of 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one (CID 58676736) is 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one.
What is the SMILES notation for 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one?
The canonical SMILES for 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one is O=c1oc2cc(O)ccc2c(CO)c1CO.
What is the InChIKey of 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one?
The InChIKey is WFQDEIGIYSNSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5/c12-4-8-7-2-1-6(14)3-10(7)16-11(15)9(8)5-13/h1-3,12-14H,4-5H2.
What are the key properties of 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one?
7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one has a molecular weight of 222.20 g/mol, XLogP of 0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3,4-bis(hydroxymethyl)chromen-2-one is sourced from PubChem (CID 58676736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).