C26H14O8 — CID 11510769
9-(3,8-dihydroxy-6-oxobenzo[c]chromen-9-yl)-3,8-dihydroxybenzo[c]chromen-6-one (PubChem CID 11510769) has the molecular formula C26H14O8 and a molecular weight of 454.39 g/mol. Its IUPAC name is 9-(3,8-dihydroxy-6-oxobenzo[c]chromen-9-yl)-3,8-dihydroxybenzo[c]chromen-6-one.
| Compound Name | 9-(3,8-dihydroxy-6-oxobenzo[c]chromen-9-yl)-3,8-dihydroxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 11510769 |
| Molecular Formula | C26H14O8 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 9-(3,8-dihydroxy-6-oxobenzo[c]chromen-9-yl)-3,8-dihydroxybenzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)ccc2c2cc(-c3cc4c(cc3O)c(=O)oc3cc(O)ccc34)c(O)cc12 |
| InChI | InChI=1S/C26H14O8/c27-11-1-3-13-15-7-17(21(29)9-19(15)25(31)33-23(13)5-11)18-8-16-14-4-2-12(28)6-24(14)34-26(32)20(16)10-22(18)30/h1-10,27-30H |
| InChIKey | OHVHPHOWNRTMHJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|