About 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one
7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one (PubChem CID 171936140) has the molecular formula C14H8O5
and a molecular weight of 256.21 g/mol. Its IUPAC name is 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one.
Molecular Properties
| Compound Name | 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one |
| PubChem CID | 171936140 |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one |
| SMILES | O=c1oc2cc(O)ccc2c2ccc3c(c12)OCO3 |
| InChI | InChI=1S/C14H8O5/c15-7-1-2-8-9-3-4-10-13(18-6-17-10)12(9)14(16)19-11(8)5-7/h1-5,15H,6H2 |
| InChIKey | GMCUXEBPOQWFCZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one?
The IUPAC name of 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one (CID 171936140) is 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one.
What is the SMILES notation for 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one?
The canonical SMILES for 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one is O=c1oc2cc(O)ccc2c2ccc3c(c12)OCO3.
What is the InChIKey of 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one?
The InChIKey is GMCUXEBPOQWFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O5/c15-7-1-2-8-9-3-4-10-13(18-6-17-10)12(9)14(16)19-11(8)5-7/h1-5,15H,6H2.
What are the key properties of 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one?
7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one has a molecular weight of 256.21 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-[1,3]benzodioxolo[7,6-c]chromen-4-one is sourced from PubChem (CID 171936140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).